C24H20Cl2FNO3 — CID 6637073
(3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(4-hydroxy-3,5-dimethylphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637073) has the molecular formula C24H20Cl2FNO3 and a molecular weight of 460.33 g/mol. Its IUPAC name is (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(4-hydroxy-3,5-dimethylphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(4-hydroxy-3,5-dimethylphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637073 |
| Molecular Formula | C24H20Cl2FNO3 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(4-hydroxy-3,5-dimethylphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)[C@@]2(Cl)[C@H]1c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C24H20Cl2FNO3/c1-4-15-9-10-23(25)21(30)28(18-7-5-17(27)6-8-18)22(31)24(23,26)19(15)16-11-13(2)20(29)14(3)12-16/h4-9,11-12,19,29H,1,10H2,2-3H3/t19-,23-,24+/m1/s1 |
| InChIKey | OYUNJASUSCSXKI-FOVJLYNBSA-N |
| XLogP | 5.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|