C22H11Cl3F5NO3 — CID 5069773
3a,7a-dichloro-4-(2-chloro-4-hydroxyphenyl)-5-ethenyl-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 5069773) has the molecular formula C22H11Cl3F5NO3 and a molecular weight of 538.68 g/mol. Its IUPAC name is 3a,7a-dichloro-4-(2-chloro-4-hydroxyphenyl)-5-ethenyl-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | 3a,7a-dichloro-4-(2-chloro-4-hydroxyphenyl)-5-ethenyl-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 5069773 |
| Molecular Formula | C22H11Cl3F5NO3 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 536.97 |
| IUPAC Name | 3a,7a-dichloro-4-(2-chloro-4-hydroxyphenyl)-5-ethenyl-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)N(c3c(F)c(F)c(F)c(F)c3F)C(=O)C2(Cl)C1c1ccc(O)cc1Cl |
| InChI | InChI=1S/C22H11Cl3F5NO3/c1-2-8-5-6-21(24)19(33)31(18-16(29)14(27)13(26)15(28)17(18)30)20(34)22(21,25)12(8)10-4-3-9(32)7-11(10)23/h2-5,7,12,32H,1,6H2 |
| InChIKey | NZCOVPFFLBEWPP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|