C18H16BrCl2NO4 — CID 6637019
(3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-5-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637019) has the molecular formula C18H16BrCl2NO4 and a molecular weight of 461.14 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-5-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-5-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637019 |
| Molecular Formula | C18H16BrCl2NO4 |
| Molecular Weight | 461.14 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | (3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-5-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(CBr)C(=O)[C@@]2(Cl)[C@H]1c1cc(OC)ccc1O |
| InChI | InChI=1S/C18H16BrCl2NO4/c1-3-10-6-7-17(20)15(24)22(9-19)16(25)18(17,21)14(10)12-8-11(26-2)4-5-13(12)23/h3-6,8,14,23H,1,7,9H2,2H3/t14-,17-,18+/m1/s1 |
| InChIKey | GREADVGTSRXHHZ-OLMNPRSZSA-N |
| XLogP | 3.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|