C20H18BrCl2NO4 — CID 6637111
(3aS,4S,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637111) has the molecular formula C20H18BrCl2NO4 and a molecular weight of 487.18 g/mol. Its IUPAC name is (3aS,4S,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637111 |
| Molecular Formula | C20H18BrCl2NO4 |
| Molecular Weight | 487.18 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | (3aS,4S,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(CBr)C(=O)[C@@]2(Cl)[C@H]1C=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H18BrCl2NO4/c1-3-13-8-9-19(22)17(26)24(11-21)18(27)20(19,23)14(13)6-4-12-5-7-15(25)16(10-12)28-2/h3-8,10,14,25H,1,9,11H2,2H3/t14-,19+,20-/m0/s1 |
| InChIKey | BEHULVSZFKCOBF-KPOBHBOGSA-N |
| XLogP | 4.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|