C21H20BrCl2NO5 — CID 3307685
2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione (PubChem CID 3307685) has the molecular formula C21H20BrCl2NO5 and a molecular weight of 517.20 g/mol. Its IUPAC name is 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione.
| Compound Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3307685 |
| Molecular Formula | C21H20BrCl2NO5 |
| Molecular Weight | 517.20 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)N(CBr)C(=O)C2(Cl)C1C=Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C21H20BrCl2NO5/c1-4-13-7-8-20(23)18(27)25(11-22)19(28)21(20,24)14(13)6-5-12-9-15(29-2)17(26)16(10-12)30-3/h4-7,9-10,14,26H,1,8,11H2,2-3H3 |
| InChIKey | QAHOTNWZEOXLKK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|