C19H18BrCl2NO5 — CID 4126763
2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 4126763) has the molecular formula C19H18BrCl2NO5 and a molecular weight of 491.17 g/mol. Its IUPAC name is 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4126763 |
| Molecular Formula | C19H18BrCl2NO5 |
| Molecular Weight | 491.17 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)N(CBr)C(=O)C2(Cl)C1c1c(OC)cc(O)cc1OC |
| InChI | InChI=1S/C19H18BrCl2NO5/c1-4-10-5-6-18(21)16(25)23(9-20)17(26)19(18,22)15(10)14-12(27-2)7-11(24)8-13(14)28-3/h4-5,7-8,15,24H,1,6,9H2,2-3H3 |
| InChIKey | FNORRGLULJTJBW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|