C19H19Cl2NO5 — CID 6637084
(3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637084) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637084 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(C)C(=O)[C@@]2(Cl)[C@H]1c1c(OC)cc(O)cc1OC |
| InChI | InChI=1S/C19H19Cl2NO5/c1-5-10-6-7-18(20)16(24)22(2)17(25)19(18,21)15(10)14-12(26-3)8-11(23)9-13(14)27-4/h5-6,8-9,15,23H,1,7H2,2-4H3/t15-,18-,19+/m1/s1 |
| InChIKey | KYYJINWTFITTEJ-LZQZEXGQSA-N |
| XLogP | 2.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|