C21H16BrCl2NO3 — CID 4081309
2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxynaphthalen-1-yl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 4081309) has the molecular formula C21H16BrCl2NO3 and a molecular weight of 481.17 g/mol. Its IUPAC name is 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxynaphthalen-1-yl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxynaphthalen-1-yl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4081309 |
| Molecular Formula | C21H16BrCl2NO3 |
| Molecular Weight | 481.17 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxynaphthalen-1-yl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)N(CBr)C(=O)C2(Cl)C1c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C21H16BrCl2NO3/c1-2-12-9-10-20(23)18(27)25(11-22)19(28)21(20,24)17(12)15-7-8-16(26)14-6-4-3-5-13(14)15/h2-9,17,26H,1,10-11H2 |
| InChIKey | KVFVAZHVYJVQSA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|