C24H20BrCl2NO4 — CID 4136197
2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 4136197) has the molecular formula C24H20BrCl2NO4 and a molecular weight of 537.24 g/mol. Its IUPAC name is 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4136197 |
| Molecular Formula | C24H20BrCl2NO4 |
| Molecular Weight | 537.24 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | 2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)N(CBr)C(=O)C2(Cl)C1c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C24H20BrCl2NO4/c1-2-16-10-11-23(26)21(30)28(14-25)22(31)24(23,27)20(16)18-9-8-17(12-19(18)29)32-13-15-6-4-3-5-7-15/h2-10,12,20,29H,1,11,13-14H2 |
| InChIKey | GNOQKUOTHIHHLE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|