C18H19ClN2O3S2 — CID 41310223
(E)-3-(2-chlorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]prop-2-enamide (PubChem CID 41310223) has the molecular formula C18H19ClN2O3S2 and a molecular weight of 410.95 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 41310223 |
| Molecular Formula | C18H19ClN2O3S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NCc1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C18H19ClN2O3S2/c19-16-6-2-1-5-14(16)7-9-17(22)20-13-15-8-10-18(25-15)26(23,24)21-11-3-4-12-21/h1-2,5-10H,3-4,11-13H2,(H,20,22)/b9-7+ |
| InChIKey | LLWJRSTUSXRWQI-VQHVLOKHSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|