C28H21N3OS — CID 41329471
(2S)-1'-benzhydryl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (PubChem CID 41329471) has the molecular formula C28H21N3OS and a molecular weight of 447.56 g/mol. Its IUPAC name is (2S)-1'-benzhydryl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one.
| Compound Name | (2S)-1'-benzhydryl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 41329471 |
| Molecular Formula | C28H21N3OS |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (2S)-1'-benzhydryl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| SMILES | O=C1N(C(c2ccccc2)c2ccccc2)c2ccccc2[C@@]12NN=C(c1ccccc1)S2 |
| InChI | InChI=1S/C28H21N3OS/c32-27-28(30-29-26(33-28)22-16-8-3-9-17-22)23-18-10-11-19-24(23)31(27)25(20-12-4-1-5-13-20)21-14-6-2-7-15-21/h1-19,25,30H/t28-/m0/s1 |
| InChIKey | XBPATECPRFULHX-NDEPHWFRSA-N |
| XLogP | 5.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|