About 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone
1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone (PubChem CID 4135327) has the molecular formula C30H32NOP
and a molecular weight of 453.57 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone |
| PubChem CID | 4135327 |
| Molecular Formula | C30H32NOP |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone |
| SMILES | O=C(CN=P(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H32NOP/c32-29(30-19-23-16-24(20-30)18-25(17-23)21-30)22-31-33(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-15,23-25H,16-22H2 |
| InChIKey | ZKARLFLDXUWYIH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone?
The IUPAC name of 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone (CID 4135327) is 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone.
What is the SMILES notation for 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone?
The canonical SMILES for 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone is O=C(CN=P(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone?
The InChIKey is ZKARLFLDXUWYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32NOP/c32-29(30-19-23-16-24(20-30)18-25(17-23)21-30)22-31-33(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-15,23-25H,16-22H2.
What are the key properties of 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone?
1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone has a molecular weight of 453.57 g/mol, XLogP of 5.95, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-2-[(triphenyl-λ5-phosphanylidene)amino]ethanone is sourced from PubChem (CID 4135327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).