C21H16FN3O2S — CID 41361416
2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 41361416) has the molecular formula C21H16FN3O2S and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 41361416 |
| Molecular Formula | C21H16FN3O2S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2ncc(-c3ccc(F)cc3)o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H16FN3O2S/c1-2-11-25-20(26)16-5-3-4-6-17(16)24-21(25)28-13-19-23-12-18(27-19)14-7-9-15(22)10-8-14/h2-10,12H,1,11,13H2 |
| InChIKey | QHOYNHAJMRCIQH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|