C15H16N2O4S — CID 4136913
methyl 2-[2-[2-(4-methylanilino)-2-oxoethylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 4136913) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is methyl 2-[2-[2-(4-methylanilino)-2-oxoethylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | methyl 2-[2-[2-(4-methylanilino)-2-oxoethylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 4136913 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | methyl 2-[2-[2-(4-methylanilino)-2-oxoethylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | COC(=O)CC1SC(=CC(=O)Nc2ccc(C)cc2)NC1=O |
| InChI | InChI=1S/C15H16N2O4S/c1-9-3-5-10(6-4-9)16-12(18)8-13-17-15(20)11(22-13)7-14(19)21-2/h3-6,8,11H,7H2,1-2H3,(H,16,18)(H,17,20) |
| InChIKey | NMFGTPKUQLJWOD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|