C10H11Cl2NOS — CID 4137558
S-propyl N-(2,3-dichlorophenyl)carbamothioate (PubChem CID 4137558) has the molecular formula C10H11Cl2NOS and a molecular weight of 264.18 g/mol. Its IUPAC name is S-propyl N-(2,3-dichlorophenyl)carbamothioate.
| Compound Name | S-propyl N-(2,3-dichlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 4137558 |
| Molecular Formula | C10H11Cl2NOS |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | S-propyl N-(2,3-dichlorophenyl)carbamothioate |
| SMILES | CCCSC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2NOS/c1-2-6-15-10(14)13-8-5-3-4-7(11)9(8)12/h3-5H,2,6H2,1H3,(H,13,14) |
| InChIKey | GNWBAMAUIKGUOK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|