C16H17N5O5S — CID 41385215
(6S)-4,4-dimethyl-N-(2-methyl-5-nitrophenyl)-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide (PubChem CID 41385215) has the molecular formula C16H17N5O5S and a molecular weight of 391.41 g/mol. Its IUPAC name is (6S)-4,4-dimethyl-N-(2-methyl-5-nitrophenyl)-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide.
| Compound Name | (6S)-4,4-dimethyl-N-(2-methyl-5-nitrophenyl)-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 41385215 |
| Molecular Formula | C16H17N5O5S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (6S)-4,4-dimethyl-N-(2-methyl-5-nitrophenyl)-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CC(=O)N2C(=S)NC(=O)C(C)(C)N12 |
| InChI | InChI=1S/C16H17N5O5S/c1-8-4-5-9(21(25)26)6-10(8)17-13(23)11-7-12(22)19-15(27)18-14(24)16(2,3)20(11)19/h4-6,11H,7H2,1-3H3,(H,17,23)(H,18,24,27)/t11-/m0/s1 |
| InChIKey | YKHAINYTURCCQI-NSHDSACASA-N |
| XLogP | 0.85 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|