C15H17N3O4S — CID 43025489
7a-methyl-N-(2-methyl-5-nitrophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 43025489) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 7a-methyl-N-(2-methyl-5-nitrophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-N-(2-methyl-5-nitrophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 43025489 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 7a-methyl-N-(2-methyl-5-nitrophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C15H17N3O4S/c1-9-3-4-10(18(21)22)7-11(9)16-14(20)12-8-23-15(2)6-5-13(19)17(12)15/h3-4,7,12H,5-6,8H2,1-2H3,(H,16,20) |
| InChIKey | HDMSARMMGRGJEO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|