C22H24ClN3O5 — CID 41391246
N-[2-chloro-4-[[(3S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]phenyl]acetamide (PubChem CID 41391246) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is N-[2-chloro-4-[[(3S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[[(3S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 41391246 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[2-chloro-4-[[(3S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]phenyl]acetamide |
| SMILES | COc1ccc(CCN2C(=O)C[C@H](Nc3ccc(NC(C)=O)c(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C22H24ClN3O5/c1-13(27)24-17-6-5-15(11-16(17)23)25-18-12-21(28)26(22(18)29)9-8-14-4-7-19(30-2)20(10-14)31-3/h4-7,10-11,18,25H,8-9,12H2,1-3H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | GSRZBZKEVAVHDW-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|