C23H27N3O6 — CID 4855014
N-[3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]-4-methoxyphenyl]acetamide (PubChem CID 4855014) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is N-[3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]-4-methoxyphenyl]acetamide.
| Compound Name | N-[3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 4855014 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-[3-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxopyrrolidin-3-yl]amino]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC1CC(=O)N(CCc2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C23H27N3O6/c1-14(27)24-16-6-8-19(30-2)17(12-16)25-18-13-22(28)26(23(18)29)10-9-15-5-7-20(31-3)21(11-15)32-4/h5-8,11-12,18,25H,9-10,13H2,1-4H3,(H,24,27) |
| InChIKey | XACUWODWHQHCMX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|