C17H21NO4S — CID 4143332
1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1-oxidopyridin-1-ium-2-yl)sulfanylbutane-1,3-diol (PubChem CID 4143332) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1-oxidopyridin-1-ium-2-yl)sulfanylbutane-1,3-diol.
| Compound Name | 1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1-oxidopyridin-1-ium-2-yl)sulfanylbutane-1,3-diol |
|---|---|
| PubChem CID | 4143332 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1-oxidopyridin-1-ium-2-yl)sulfanylbutane-1,3-diol |
| SMILES | CC(C(O)CSc1cccc[n+]1[O-])C(O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C17H21NO4S/c1-12(17(21)14-7-5-13(10-19)6-8-14)15(20)11-23-16-4-2-3-9-18(16)22/h2-9,12,15,17,19-21H,10-11H2,1H3 |
| InChIKey | QUVKGTTXHWECAZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|