C28H51NO3 — CID 3595074
4-(dioctylamino)-1-[4-(hydroxymethyl)phenyl]-2-methylbutane-1,3-diol (PubChem CID 3595074) has the molecular formula C28H51NO3 and a molecular weight of 449.72 g/mol. Its IUPAC name is 4-(dioctylamino)-1-[4-(hydroxymethyl)phenyl]-2-methylbutane-1,3-diol.
| Compound Name | 4-(dioctylamino)-1-[4-(hydroxymethyl)phenyl]-2-methylbutane-1,3-diol |
|---|---|
| PubChem CID | 3595074 |
| Molecular Formula | C28H51NO3 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.39 |
| IUPAC Name | 4-(dioctylamino)-1-[4-(hydroxymethyl)phenyl]-2-methylbutane-1,3-diol |
| SMILES | CCCCCCCCN(CCCCCCCC)CC(O)C(C)C(O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C28H51NO3/c1-4-6-8-10-12-14-20-29(21-15-13-11-9-7-5-2)22-27(31)24(3)28(32)26-18-16-25(23-30)17-19-26/h16-19,24,27-28,30-32H,4-15,20-23H2,1-3H3 |
| InChIKey | GJZAKEQNVANHRN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|