C24H28N2O5 — CID 41455831
methyl (6R)-6-(4-ethoxyphenyl)-9,9-dimethyl-4,7-dioxo-1,2,3,6,8,10-hexahydropyrazino[1,2-a]quinoline-5-carboxylate (PubChem CID 41455831) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl (6R)-6-(4-ethoxyphenyl)-9,9-dimethyl-4,7-dioxo-1,2,3,6,8,10-hexahydropyrazino[1,2-a]quinoline-5-carboxylate.
| Compound Name | methyl (6R)-6-(4-ethoxyphenyl)-9,9-dimethyl-4,7-dioxo-1,2,3,6,8,10-hexahydropyrazino[1,2-a]quinoline-5-carboxylate |
|---|---|
| PubChem CID | 41455831 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl (6R)-6-(4-ethoxyphenyl)-9,9-dimethyl-4,7-dioxo-1,2,3,6,8,10-hexahydropyrazino[1,2-a]quinoline-5-carboxylate |
| SMILES | CCOc1ccc([C@@H]2C3=C(CC(C)(C)CC3=O)N3CCNC(=O)C3=C2C(=O)OC)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-5-31-15-8-6-14(7-9-15)18-19-16(12-24(2,3)13-17(19)27)26-11-10-25-22(28)21(26)20(18)23(29)30-4/h6-9,18H,5,10-13H2,1-4H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | DARCEJJAANAMQZ-GOSISDBHSA-N |
| XLogP | 2.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |