C20H19ClN2O4 — CID 5306273
methyl 6-(4-chlorophenyl)-4,7-dioxo-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate (PubChem CID 5306273) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is methyl 6-(4-chlorophenyl)-4,7-dioxo-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate.
| Compound Name | methyl 6-(4-chlorophenyl)-4,7-dioxo-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate |
|---|---|
| PubChem CID | 5306273 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | methyl 6-(4-chlorophenyl)-4,7-dioxo-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate |
| SMILES | COC(=O)C1=C2C(=O)NCCN2C2=C(C(=O)CCC2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O4/c1-27-20(26)17-15(11-5-7-12(21)8-6-11)16-13(3-2-4-14(16)24)23-10-9-22-19(25)18(17)23/h5-8,15H,2-4,9-10H2,1H3,(H,22,25) |
| InChIKey | RDRWIGKQBPMTSY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |