C20H20N2O4 — CID 5306275
methyl 4,7-dioxo-6-phenyl-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate (PubChem CID 5306275) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 4,7-dioxo-6-phenyl-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate.
| Compound Name | methyl 4,7-dioxo-6-phenyl-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate |
|---|---|
| PubChem CID | 5306275 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl 4,7-dioxo-6-phenyl-2,3,6,8,9,10-hexahydro-1H-pyrazino[1,2-a]quinoline-5-carboxylate |
| SMILES | COC(=O)C1=C2C(=O)NCCN2C2=C(C(=O)CCC2)C1c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c1-26-20(25)17-15(12-6-3-2-4-7-12)16-13(8-5-9-14(16)23)22-11-10-21-19(24)18(17)22/h2-4,6-7,15H,5,8-11H2,1H3,(H,21,24) |
| InChIKey | SXHIMHBKKQPYGN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |