C19H14ClN7O4S — CID 4146673
N-[2-(2-amino-3-cyanopyrrolo[3,2-b]quinoxalin-1-yl)ethyl]-4-chloro-3-nitrobenzenesulfonamide (PubChem CID 4146673) has the molecular formula C19H14ClN7O4S and a molecular weight of 471.89 g/mol. Its IUPAC name is N-[2-(2-amino-3-cyanopyrrolo[3,2-b]quinoxalin-1-yl)ethyl]-4-chloro-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2-amino-3-cyanopyrrolo[3,2-b]quinoxalin-1-yl)ethyl]-4-chloro-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4146673 |
| Molecular Formula | C19H14ClN7O4S |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | N-[2-(2-amino-3-cyanopyrrolo[3,2-b]quinoxalin-1-yl)ethyl]-4-chloro-3-nitrobenzenesulfonamide |
| SMILES | N#Cc1c(N)n(CCNS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C19H14ClN7O4S/c20-13-6-5-11(9-16(13)27(28)29)32(30,31)23-7-8-26-18(22)12(10-21)17-19(26)25-15-4-2-1-3-14(15)24-17/h1-6,9,23H,7-8,22H2 |
| InChIKey | XURPTXCIDBMLPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|