C21H25N3O6S — CID 41483297
N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide (PubChem CID 41483297) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide.
| Compound Name | N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 41483297 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccc(N3CCCS3(=O)=O)c2)ccc1OC(C)C |
| InChI | InChI=1S/C21H25N3O6S/c1-14(2)30-18-9-8-16(13-19(18)29-3)21(26)23-22-20(25)15-6-4-7-17(12-15)24-10-5-11-31(24,27)28/h4,6-9,12-14H,5,10-11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | WHSBBDWSVRRXMU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|