C18H22N6O2S — CID 41493019
N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-methylacetamide (PubChem CID 41493019) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 41493019 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-methylacetamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)CSc1nnnn1Cc1ccco1 |
| InChI | InChI=1S/C18H22N6O2S/c1-22(2)15-8-6-14(7-9-15)11-23(3)17(25)13-27-18-19-20-21-24(18)12-16-5-4-10-26-16/h4-10H,11-13H2,1-3H3 |
| InChIKey | YCYBEUHJNQWYAB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|