methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate

C13H13N3O5 — CID 4159286

IUPACmethyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate
SMILESCOC(=O)c1ccccc1Oc1nc(OC)nc(OC)n1
InChIInChI=1S/C13H13N3O5/c1-18-10(17)8-6-4-5-7-9(8)21-13-15-11(19-2)14-12(16-13)20-3/h4-7H,1-3H3
InChIKeyDPSLDVOEPSHSSK-UHFFFAOYSA-N
MW291.26 g/mol
LogP1.47
Rot. Bonds5

About methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate

methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate (PubChem CID 4159286) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate.

Molecular Properties

Compound Namemethyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate
PubChem CID4159286
Molecular FormulaC13H13N3O5
Molecular Weight291.26 g/mol
Exact Mass291.09
IUPAC Namemethyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate
SMILESCOC(=O)c1ccccc1Oc1nc(OC)nc(OC)n1
InChIInChI=1S/C13H13N3O5/c1-18-10(17)8-6-4-5-7-9(8)21-13-15-11(19-2)14-12(16-13)20-3/h4-7H,1-3H3
InChIKeyDPSLDVOEPSHSSK-UHFFFAOYSA-N
XLogP1.47
TPSA92.66 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.26
LogP ≤ 51.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate?
The IUPAC name of methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate (CID 4159286) is methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate.
What is the SMILES notation for methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate?
The canonical SMILES for methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate is COC(=O)c1ccccc1Oc1nc(OC)nc(OC)n1.
What is the InChIKey of methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate?
The InChIKey is DPSLDVOEPSHSSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O5/c1-18-10(17)8-6-4-5-7-9(8)21-13-15-11(19-2)14-12(16-13)20-3/h4-7H,1-3H3.
What are the key properties of methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate?
methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate has a molecular weight of 291.26 g/mol, XLogP of 1.47, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate is sourced from PubChem (CID 4159286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).