C13H13N3O5 — CID 4159286
methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate (PubChem CID 4159286) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate.
| Compound Name | methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate |
|---|---|
| PubChem CID | 4159286 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy]benzoate |
| SMILES | COC(=O)c1ccccc1Oc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C13H13N3O5/c1-18-10(17)8-6-4-5-7-9(8)21-13-15-11(19-2)14-12(16-13)20-3/h4-7H,1-3H3 |
| InChIKey | DPSLDVOEPSHSSK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |