C12H10FN3O4 — CID 175448171
1,3,5-triazin-2-yl 2-fluoro-4,6-dimethoxybenzoate (PubChem CID 175448171) has the molecular formula C12H10FN3O4 and a molecular weight of 279.23 g/mol. Its IUPAC name is 1,3,5-triazin-2-yl 2-fluoro-4,6-dimethoxybenzoate.
| Compound Name | 1,3,5-triazin-2-yl 2-fluoro-4,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 175448171 |
| Molecular Formula | C12H10FN3O4 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1,3,5-triazin-2-yl 2-fluoro-4,6-dimethoxybenzoate |
| SMILES | COc1cc(F)c(C(=O)Oc2ncncn2)c(OC)c1 |
| InChI | InChI=1S/C12H10FN3O4/c1-18-7-3-8(13)10(9(4-7)19-2)11(17)20-12-15-5-14-6-16-12/h3-6H,1-2H3 |
| InChIKey | JTQSRIRNVMISBG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |