C19H15N3O7 — CID 660047
3-[[4-(3-carboxyphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]oxy]benzoic acid (PubChem CID 660047) has the molecular formula C19H15N3O7 and a molecular weight of 397.34 g/mol. Its IUPAC name is 3-[[4-(3-carboxyphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]oxy]benzoic acid.
| Compound Name | 3-[[4-(3-carboxyphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 660047 |
| Molecular Formula | C19H15N3O7 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-[[4-(3-carboxyphenoxy)-6-ethoxy-1,3,5-triazin-2-yl]oxy]benzoic acid |
| SMILES | CCOc1nc(Oc2cccc(C(=O)O)c2)nc(Oc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C19H15N3O7/c1-2-27-17-20-18(28-13-7-3-5-11(9-13)15(23)24)22-19(21-17)29-14-8-4-6-12(10-14)16(25)26/h3-10H,2H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | HMAVMGYVGLNEKY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 140.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |