C15H14N2O5S — CID 4161319
1-ethoxy-2-[4-(2-methoxy-2-oxoethylidene)-5-oxo-1,3-thiazol-2-yl]-2-pyridin-1-ium-1-ylethenolate (PubChem CID 4161319) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-ethoxy-2-[4-(2-methoxy-2-oxoethylidene)-5-oxo-1,3-thiazol-2-yl]-2-pyridin-1-ium-1-ylethenolate.
| Compound Name | 1-ethoxy-2-[4-(2-methoxy-2-oxoethylidene)-5-oxo-1,3-thiazol-2-yl]-2-pyridin-1-ium-1-ylethenolate |
|---|---|
| PubChem CID | 4161319 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-ethoxy-2-[4-(2-methoxy-2-oxoethylidene)-5-oxo-1,3-thiazol-2-yl]-2-pyridin-1-ium-1-ylethenolate |
| SMILES | CCOC([O-])=C(C1=NC(=CC(=O)OC)C(=O)S1)[n+]1ccccc1 |
| InChI | InChI=1S/C15H14N2O5S/c1-3-22-14(19)12(17-7-5-4-6-8-17)13-16-10(15(20)23-13)9-11(18)21-2/h4-9H,3H2,1-2H3 |
| InChIKey | UNXBHNMXPNUFLN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|