C23H17ClI2N4O2S — CID 4164153
2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 4164153) has the molecular formula C23H17ClI2N4O2S and a molecular weight of 702.74 g/mol. Its IUPAC name is 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4164153 |
| Molecular Formula | C23H17ClI2N4O2S |
| Molecular Weight | 702.74 g/mol |
| Exact Mass | 701.89 |
| IUPAC Name | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2n1Cc1ccccc1Cl)NN=Cc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C23H17ClI2N4O2S/c24-17-6-2-1-5-14(17)12-30-20-8-4-3-7-19(20)28-23(30)33-13-21(31)29-27-11-15-9-16(25)10-18(26)22(15)32/h1-11,32H,12-13H2,(H,29,31) |
| InChIKey | LYMMCNBINKCENC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|