C23H19ClN4O2S — CID 6823505
2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[3-(furan-2-yl)prop-2-enylideneamino]acetamide (PubChem CID 6823505) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[3-(furan-2-yl)prop-2-enylideneamino]acetamide.
| Compound Name | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[3-(furan-2-yl)prop-2-enylideneamino]acetamide |
|---|---|
| PubChem CID | 6823505 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[3-(furan-2-yl)prop-2-enylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2n1Cc1ccccc1Cl)NN=CC=Cc1ccco1 |
| InChI | InChI=1S/C23H19ClN4O2S/c24-19-10-2-1-7-17(19)15-28-21-12-4-3-11-20(21)26-23(28)31-16-22(29)27-25-13-5-8-18-9-6-14-30-18/h1-14H,15-16H2,(H,27,29) |
| InChIKey | XGXNBYXDSDRMOP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_65_C(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|