C25H22ClFN4O3S — CID 44538058
2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(E)-(2-fluoro-4,5-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 44538058) has the molecular formula C25H22ClFN4O3S and a molecular weight of 512.99 g/mol. Its IUPAC name is 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(E)-(2-fluoro-4,5-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(E)-(2-fluoro-4,5-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 44538058 |
| Molecular Formula | C25H22ClFN4O3S |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 2-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(E)-(2-fluoro-4,5-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(F)c(/C=N/NC(=O)CSc2nc3ccccc3n2Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C25H22ClFN4O3S/c1-33-22-11-17(19(27)12-23(22)34-2)13-28-30-24(32)15-35-25-29-20-9-5-6-10-21(20)31(25)14-16-7-3-4-8-18(16)26/h3-13H,14-15H2,1-2H3,(H,30,32)/b28-13+ |
| InChIKey | JTUWIBOTNVLCQV-XODNFHPESA-N |
| XLogP | 5.14 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|