C19H14BrN5O3 — CID 4166282
N-[4-[4-[(4-bromophenyl)methylidene]-5-oxo-1,3-oxazolidin-2-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 4166282) has the molecular formula C19H14BrN5O3 and a molecular weight of 440.26 g/mol. Its IUPAC name is N-[4-[4-[(4-bromophenyl)methylidene]-5-oxo-1,3-oxazolidin-2-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[4-[4-[(4-bromophenyl)methylidene]-5-oxo-1,3-oxazolidin-2-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 4166282 |
| Molecular Formula | C19H14BrN5O3 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | N-[4-[4-[(4-bromophenyl)methylidene]-5-oxo-1,3-oxazolidin-2-yl]phenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C1OC(c2ccc(NC(=O)c3ncn[nH]3)cc2)NC1=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14BrN5O3/c20-13-5-1-11(2-6-13)9-15-19(27)28-18(24-15)12-3-7-14(8-4-12)23-17(26)16-21-10-22-25-16/h1-10,18,24H,(H,23,26)(H,21,22,25) |
| InChIKey | MGNXNFNRTMKPHR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|