C38H46F3NO7 — CID 4169760
[5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone (PubChem CID 4169760) has the molecular formula C38H46F3NO7 and a molecular weight of 685.78 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 4169760 |
| Molecular Formula | C38H46F3NO7 |
| Molecular Weight | 685.78 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccco4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1ccc(OC(F)(F)F)cc1)CC(O)CO |
| InChI | InChI=1S/C38H46F3NO7/c1-33-12-9-25(44)18-35(33)15-16-37(28(19-35)32(46)29-4-3-17-48-29)30(33)10-13-34(2)31(37)11-14-36(34,47)23-42(21-26(45)22-43)20-24-5-7-27(8-6-24)49-38(39,40)41/h3-8,15-17,19,25-26,30-31,43-45,47H,9-14,18,20-23H2,1-2H3 |
| InChIKey | DLGBAELNQMFATD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|