C37H45FN2O4 — CID 3371099
[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone (PubChem CID 3371099) has the molecular formula C37H45FN2O4 and a molecular weight of 600.78 g/mol. Its IUPAC name is [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone.
| Compound Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3371099 |
| Molecular Formula | C37H45FN2O4 |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccco4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C37H45FN2O4/c1-33-12-9-27(41)22-35(33)15-16-37(28(23-35)32(42)29-4-3-21-44-29)30(33)10-13-34(2)31(37)11-14-36(34,43)24-39-17-19-40(20-18-39)26-7-5-25(38)6-8-26/h3-8,15-16,21,23,27,30-31,41,43H,9-14,17-20,22,24H2,1-2H3 |
| InChIKey | MPFRBIBPSWQKNL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|