C18H20N4O7S — CID 4169961
N-[(2,5-dimethoxyphenyl)methylideneamino]-2-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 4169961) has the molecular formula C18H20N4O7S and a molecular weight of 436.45 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methylideneamino]-2-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methylideneamino]-2-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 4169961 |
| Molecular Formula | C18H20N4O7S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methylideneamino]-2-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(OC)c(C=NNC(=O)C(C)NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C18H20N4O7S/c1-12(21-30(26,27)16-7-4-14(5-8-16)22(24)25)18(23)20-19-11-13-10-15(28-2)6-9-17(13)29-3/h4-12,21H,1-3H3,(H,20,23) |
| InChIKey | CJDJTOIZODEOCX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|