C20H25BrN2O2S — CID 4177220
N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide (PubChem CID 4177220) has the molecular formula C20H25BrN2O2S and a molecular weight of 437.40 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide.
| Compound Name | N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 4177220 |
| Molecular Formula | C20H25BrN2O2S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)propylideneamino]-2-hydroxy-3,5-di(propan-2-yl)benzamide |
| SMILES | CCC(=NNC(=O)c1cc(C(C)C)cc(C(C)C)c1O)c1ccc(Br)s1 |
| InChI | InChI=1S/C20H25BrN2O2S/c1-6-16(17-7-8-18(21)26-17)22-23-20(25)15-10-13(11(2)3)9-14(12(4)5)19(15)24/h7-12,24H,6H2,1-5H3,(H,23,25) |
| InChIKey | MBUJHVGMWPVWBW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|