C22H25ClN2OS — CID 4181697
N-[1-(1-adamantyl)ethylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 4181697) has the molecular formula C22H25ClN2OS and a molecular weight of 400.98 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4181697 |
| Molecular Formula | C22H25ClN2OS |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[1-(1-adamantyl)ethylideneamino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1sc2cc(C)ccc2c1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H25ClN2OS/c1-12-3-4-17-18(5-12)27-20(19(17)23)21(26)25-24-13(2)22-9-14-6-15(10-22)8-16(7-14)11-22/h3-5,14-16H,6-11H2,1-2H3,(H,25,26) |
| InChIKey | KTYHVEHLSXZOMF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|