C25H24N4OS2 — CID 4184924
6-oxo-4-N,11-N-diphenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-4,11-dicarbothioamide (PubChem CID 4184924) has the molecular formula C25H24N4OS2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 6-oxo-4-N,11-N-diphenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-4,11-dicarbothioamide.
| Compound Name | 6-oxo-4-N,11-N-diphenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-4,11-dicarbothioamide |
|---|---|
| PubChem CID | 4184924 |
| Molecular Formula | C25H24N4OS2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 6-oxo-4-N,11-N-diphenyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-4,11-dicarbothioamide |
| SMILES | O=c1cc(C(=S)Nc2ccccc2)cc2n1CC1CC2CN(C(=S)Nc2ccccc2)C1 |
| InChI | InChI=1S/C25H24N4OS2/c30-23-13-18(24(31)26-20-7-3-1-4-8-20)12-22-19-11-17(15-29(22)23)14-28(16-19)25(32)27-21-9-5-2-6-10-21/h1-10,12-13,17,19H,11,14-16H2,(H,26,31)(H,27,32) |
| InChIKey | DYJCJTUPOBIZLI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|