C18H11FN2O2S — CID 4187106
N-(4-fluorophenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 4187106) has the molecular formula C18H11FN2O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 4187106 |
| Molecular Formula | C18H11FN2O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-(4-fluorophenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc2c(=O)[nH]c3ccccc3c2s1 |
| InChI | InChI=1S/C18H11FN2O2S/c19-10-5-7-11(8-6-10)20-18(23)15-9-13-16(24-15)12-3-1-2-4-14(12)21-17(13)22/h1-9H,(H,20,23)(H,21,22) |
| InChIKey | KIHYTTNOLRAZTC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |