C27H16Br2N2O4 — CID 4190062
[2-(1,3-benzoxazol-2-yl)-5-[(2-bromobenzoyl)amino]phenyl] 2-bromobenzoate (PubChem CID 4190062) has the molecular formula C27H16Br2N2O4 and a molecular weight of 592.24 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)-5-[(2-bromobenzoyl)amino]phenyl] 2-bromobenzoate.
| Compound Name | [2-(1,3-benzoxazol-2-yl)-5-[(2-bromobenzoyl)amino]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 4190062 |
| Molecular Formula | C27H16Br2N2O4 |
| Molecular Weight | 592.24 g/mol |
| Exact Mass | 589.95 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)-5-[(2-bromobenzoyl)amino]phenyl] 2-bromobenzoate |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)c(OC(=O)c2ccccc2Br)c1)c1ccccc1Br |
| InChI | InChI=1S/C27H16Br2N2O4/c28-20-9-3-1-7-17(20)25(32)30-16-13-14-19(26-31-22-11-5-6-12-23(22)34-26)24(15-16)35-27(33)18-8-2-4-10-21(18)29/h1-15H,(H,30,32) |
| InChIKey | ZNIGYYZELJDDGU-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.24 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|