About [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate
[2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate (PubChem CID 101207304) has the molecular formula C20H12N2O5
and a molecular weight of 360.33 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate |
| PubChem CID | 101207304 |
| Molecular Formula | C20H12N2O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate |
| SMILES | O=C(Oc1ccccc1-c1nc2ccccc2o1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H12N2O5/c23-20(13-7-1-4-10-16(13)22(24)25)27-17-11-5-2-8-14(17)19-21-15-9-3-6-12-18(15)26-19/h1-12H |
| InChIKey | JDAFZXOAXFRQRL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate?
The IUPAC name of [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate (CID 101207304) is [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate.
What is the SMILES notation for [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate?
The canonical SMILES for [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate is O=C(Oc1ccccc1-c1nc2ccccc2o1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate?
The InChIKey is JDAFZXOAXFRQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O5/c23-20(13-7-1-4-10-16(13)22(24)25)27-17-11-5-2-8-14(17)19-21-15-9-3-6-12-18(15)26-19/h1-12H.
What are the key properties of [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate?
[2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate has a molecular weight of 360.33 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzoxazol-2-yl)phenyl] 2-nitrobenzoate is sourced from PubChem (CID 101207304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).