C12H10F3N3O4 — CID 4206761
2,2,2-trifluoro-1-[5-hydroxy-3-methylidene-5-(3-nitrophenyl)pyrazolidin-1-yl]ethanone (PubChem CID 4206761) has the molecular formula C12H10F3N3O4 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[5-hydroxy-3-methylidene-5-(3-nitrophenyl)pyrazolidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[5-hydroxy-3-methylidene-5-(3-nitrophenyl)pyrazolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 4206761 |
| Molecular Formula | C12H10F3N3O4 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[5-hydroxy-3-methylidene-5-(3-nitrophenyl)pyrazolidin-1-yl]ethanone |
| SMILES | C=C1CC(O)(c2cccc([N+](=O)[O-])c2)N(C(=O)C(F)(F)F)N1 |
| InChI | InChI=1S/C12H10F3N3O4/c1-7-6-11(20,17(16-7)10(19)12(13,14)15)8-3-2-4-9(5-8)18(21)22/h2-5,16,20H,1,6H2 |
| InChIKey | CBBXRVMCTSBBBY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|