C25H25N3O6S — CID 42068418
ethyl 2-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate (PubChem CID 42068418) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is ethyl 2-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 42068418 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | ethyl 2-[[2-[(2-methoxydibenzofuran-3-yl)amino]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CNc2cc3oc4ccccc4c3cc2OC)sc(C(=O)NC)c1C |
| InChI | InChI=1S/C25H25N3O6S/c1-5-33-25(31)21-13(2)22(23(30)26-3)35-24(21)28-20(29)12-27-16-11-18-15(10-19(16)32-4)14-8-6-7-9-17(14)34-18/h6-11,27H,5,12H2,1-4H3,(H,26,30)(H,28,29) |
| InChIKey | PYGPHJRRUCTRON-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_A(4)', 'substructure': 'N/A'} |
|---|