C21H28N2O5S — CID 9105428
ethyl 2-[[2-(4,5-dimethoxy-2-methylanilino)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate (PubChem CID 9105428) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is ethyl 2-[[2-(4,5-dimethoxy-2-methylanilino)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4,5-dimethoxy-2-methylanilino)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 9105428 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl 2-[[2-(4,5-dimethoxy-2-methylanilino)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CNc2cc(OC)c(OC)cc2C)sc(CC)c1C |
| InChI | InChI=1S/C21H28N2O5S/c1-7-17-13(4)19(21(25)28-8-2)20(29-17)23-18(24)11-22-14-10-16(27-6)15(26-5)9-12(14)3/h9-10,22H,7-8,11H2,1-6H3,(H,23,24) |
| InChIKey | YUFLFBHSYHVHGH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|