C26H40N4O5S2 — CID 3981713
ethyl 2-[[2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate (PubChem CID 3981713) has the molecular formula C26H40N4O5S2 and a molecular weight of 552.76 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3981713 |
| Molecular Formula | C26H40N4O5S2 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | ethyl 2-[[2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
| SMILES | CCCCNc1ccc(S(=O)(=O)N(CC)CC)cc1NCC(=O)Nc1sc(CC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C26H40N4O5S2/c1-7-12-15-27-20-14-13-19(37(33,34)30(9-3)10-4)16-21(20)28-17-23(31)29-25-24(26(32)35-11-5)18(6)22(8-2)36-25/h13-14,16,27-28H,7-12,15,17H2,1-6H3,(H,29,31) |
| InChIKey | CAFFLWXHUIAJSM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|