C23H32FN5O4S — CID 24510804
2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]-N-[(2-fluorophenyl)carbamoyl]acetamide (PubChem CID 24510804) has the molecular formula C23H32FN5O4S and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]-N-[(2-fluorophenyl)carbamoyl]acetamide.
| Compound Name | 2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]-N-[(2-fluorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 24510804 |
| Molecular Formula | C23H32FN5O4S |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-[2-(butylamino)-5-(diethylsulfamoyl)anilino]-N-[(2-fluorophenyl)carbamoyl]acetamide |
| SMILES | CCCCNc1ccc(S(=O)(=O)N(CC)CC)cc1NCC(=O)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H32FN5O4S/c1-4-7-14-25-20-13-12-17(34(32,33)29(5-2)6-3)15-21(20)26-16-22(30)28-23(31)27-19-11-9-8-10-18(19)24/h8-13,15,25-26H,4-7,14,16H2,1-3H3,(H2,27,28,30,31) |
| InChIKey | NOCAMZMVXPZOJH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|