C31H23N4O2+ — CID 4207420
1-methyl-5-nitro-2-(2,4,6-triphenylpyridin-1-ium-1-yl)benzimidazole (PubChem CID 4207420) has the molecular formula C31H23N4O2+ and a molecular weight of 483.55 g/mol. Its IUPAC name is 1-methyl-5-nitro-2-(2,4,6-triphenylpyridin-1-ium-1-yl)benzimidazole.
| Compound Name | 1-methyl-5-nitro-2-(2,4,6-triphenylpyridin-1-ium-1-yl)benzimidazole |
|---|---|
| PubChem CID | 4207420 |
| Molecular Formula | C31H23N4O2+ |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 1-methyl-5-nitro-2-(2,4,6-triphenylpyridin-1-ium-1-yl)benzimidazole |
| SMILES | Cn1c(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C31H23N4O2/c1-33-28-18-17-26(35(36)37)21-27(28)32-31(33)34-29(23-13-7-3-8-14-23)19-25(22-11-5-2-6-12-22)20-30(34)24-15-9-4-10-16-24/h2-21H,1H3/q+1 |
| InChIKey | YUTLZLVJYMHYQO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|